C15H16NO4P — CID 18472794
3-[hydroxy(pyridin-2-ylmethyl)phosphoryl]-2-phenylpropanoic acid (PubChem CID 18472794) has the molecular formula C15H16NO4P and a molecular weight of 305.27 g/mol. Its IUPAC name is 3-[hydroxy(pyridin-2-ylmethyl)phosphoryl]-2-phenylpropanoic acid.
| Compound Name | 3-[hydroxy(pyridin-2-ylmethyl)phosphoryl]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 18472794 |
| Molecular Formula | C15H16NO4P |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[hydroxy(pyridin-2-ylmethyl)phosphoryl]-2-phenylpropanoic acid |
| SMILES | O=C(O)C(CP(=O)(O)Cc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C15H16NO4P/c17-15(18)14(12-6-2-1-3-7-12)11-21(19,20)10-13-8-4-5-9-16-13/h1-9,14H,10-11H2,(H,17,18)(H,19,20) |
| InChIKey | TXZFTXVTRAESKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|