C11H16N2O4Pt — CID 11980320
2-ethylpropanedioic acid;platinum;pyridin-2-ylmethanamine (PubChem CID 11980320) has the molecular formula C11H16N2O4Pt and a molecular weight of 435.34 g/mol. Its IUPAC name is 2-ethylpropanedioic acid;platinum;pyridin-2-ylmethanamine.
| Compound Name | 2-ethylpropanedioic acid;platinum;pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 11980320 |
| Molecular Formula | C11H16N2O4Pt |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-ethylpropanedioic acid;platinum;pyridin-2-ylmethanamine |
| SMILES | CCC(C(=O)O)C(=O)O.NCc1ccccn1.[Pt] |
| InChI | InChI=1S/C6H8N2.C5H8O4.Pt/c7-5-6-3-1-2-4-8-6;1-2-3(4(6)7)5(8)9;/h1-4H,5,7H2;3H,2H2,1H3,(H,6,7)(H,8,9); |
| InChIKey | GDNIQHLBGQOPSG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|