About benzoic acid;pyridin-2-ylmethanamine
benzoic acid;pyridin-2-ylmethanamine (PubChem CID 174853038) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is benzoic acid;pyridin-2-ylmethanamine.
Molecular Properties
| Compound Name | benzoic acid;pyridin-2-ylmethanamine |
| PubChem CID | 174853038 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | benzoic acid;pyridin-2-ylmethanamine |
| SMILES | NCc1ccccn1.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/2C7H6O2.C6H8N2/c2*8-7(9)6-4-2-1-3-5-6;7-5-6-3-1-2-4-8-6/h2*1-5H,(H,8,9);1-4H,5,7H2 |
| InChIKey | KDOQLMNFVWFLLE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzoic acid;pyridin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;pyridin-2-ylmethanamine?
The IUPAC name of benzoic acid;pyridin-2-ylmethanamine (CID 174853038) is benzoic acid;pyridin-2-ylmethanamine.
What is the SMILES notation for benzoic acid;pyridin-2-ylmethanamine?
The canonical SMILES for benzoic acid;pyridin-2-ylmethanamine is NCc1ccccn1.O=C(O)c1ccccc1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;pyridin-2-ylmethanamine?
The InChIKey is KDOQLMNFVWFLLE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6O2.C6H8N2/c2*8-7(9)6-4-2-1-3-5-6;7-5-6-3-1-2-4-8-6/h2*1-5H,(H,8,9);1-4H,5,7H2.
What are the key properties of benzoic acid;pyridin-2-ylmethanamine?
benzoic acid;pyridin-2-ylmethanamine has a molecular weight of 352.39 g/mol, XLogP of 3.31, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;pyridin-2-ylmethanamine is sourced from PubChem (CID 174853038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).