C15H15O4P — CID 18472890
3-[hydroxy(phenyl)phosphoryl]-2-phenylpropanoic acid (PubChem CID 18472890) has the molecular formula C15H15O4P and a molecular weight of 290.25 g/mol. Its IUPAC name is 3-[hydroxy(phenyl)phosphoryl]-2-phenylpropanoic acid.
| Compound Name | 3-[hydroxy(phenyl)phosphoryl]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 18472890 |
| Molecular Formula | C15H15O4P |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[hydroxy(phenyl)phosphoryl]-2-phenylpropanoic acid |
| SMILES | O=C(O)C(CP(=O)(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15O4P/c16-15(17)14(12-7-3-1-4-8-12)11-20(18,19)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,16,17)(H,18,19) |
| InChIKey | FNBYCCJZZSVSTQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|