C16H18N3O4P — CID 10236936
2-[3-(diaminomethylideneamino)phenyl]-3-[hydroxy(phenyl)phosphoryl]propanoic acid (PubChem CID 10236936) has the molecular formula C16H18N3O4P and a molecular weight of 347.31 g/mol. Its IUPAC name is 2-[3-(diaminomethylideneamino)phenyl]-3-[hydroxy(phenyl)phosphoryl]propanoic acid.
| Compound Name | 2-[3-(diaminomethylideneamino)phenyl]-3-[hydroxy(phenyl)phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 10236936 |
| Molecular Formula | C16H18N3O4P |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[3-(diaminomethylideneamino)phenyl]-3-[hydroxy(phenyl)phosphoryl]propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(CP(=O)(O)c2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C16H18N3O4P/c17-16(18)19-12-6-4-5-11(9-12)14(15(20)21)10-24(22,23)13-7-2-1-3-8-13/h1-9,14H,10H2,(H,20,21)(H,22,23)(H4,17,18,19) |
| InChIKey | JODVLBCGSNLMNN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|