C24H25N4O7P — CID 91290414
2-[(1-amino-2-oxo-1-phenyl-2-phenylmethoxyethyl)-hydroxyphosphoryl]oxy-2-[3-(diaminomethylideneamino)phenyl]acetic acid (PubChem CID 91290414) has the molecular formula C24H25N4O7P and a molecular weight of 512.46 g/mol. Its IUPAC name is 2-[(1-amino-2-oxo-1-phenyl-2-phenylmethoxyethyl)-hydroxyphosphoryl]oxy-2-[3-(diaminomethylideneamino)phenyl]acetic acid.
| Compound Name | 2-[(1-amino-2-oxo-1-phenyl-2-phenylmethoxyethyl)-hydroxyphosphoryl]oxy-2-[3-(diaminomethylideneamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 91290414 |
| Molecular Formula | C24H25N4O7P |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 2-[(1-amino-2-oxo-1-phenyl-2-phenylmethoxyethyl)-hydroxyphosphoryl]oxy-2-[3-(diaminomethylideneamino)phenyl]acetic acid |
| SMILES | NC(N)=Nc1cccc(C(OP(=O)(O)C(N)(C(=O)OCc2ccccc2)c2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C24H25N4O7P/c25-23(26)28-19-13-7-10-17(14-19)20(21(29)30)35-36(32,33)24(27,18-11-5-2-6-12-18)22(31)34-15-16-8-3-1-4-9-16/h1-14,20H,15,27H2,(H,29,30)(H,32,33)(H4,25,26,28) |
| InChIKey | VRQPIXVYARTPQH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 200.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|