C21H26N4O7PS+ — CID 91476371
[carboxy-[3-(diaminomethylideneamino)phenyl]methoxy]-[2-methyl-1-(2-phenylethylsulfonylamino)prop-1-enoxy]-oxophosphanium (PubChem CID 91476371) has the molecular formula C21H26N4O7PS+ and a molecular weight of 509.50 g/mol. Its IUPAC name is [carboxy-[3-(diaminomethylideneamino)phenyl]methoxy]-[2-methyl-1-(2-phenylethylsulfonylamino)prop-1-enoxy]-oxophosphanium.
| Compound Name | [carboxy-[3-(diaminomethylideneamino)phenyl]methoxy]-[2-methyl-1-(2-phenylethylsulfonylamino)prop-1-enoxy]-oxophosphanium |
|---|---|
| PubChem CID | 91476371 |
| Molecular Formula | C21H26N4O7PS+ |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [carboxy-[3-(diaminomethylideneamino)phenyl]methoxy]-[2-methyl-1-(2-phenylethylsulfonylamino)prop-1-enoxy]-oxophosphanium |
| SMILES | CC(C)=C(NS(=O)(=O)CCc1ccccc1)O[P+](=O)OC(C(=O)O)c1cccc(N=C(N)N)c1 |
| InChI | InChI=1S/C21H25N4O7PS/c1-14(2)19(25-34(29,30)12-11-15-7-4-3-5-8-15)32-33(28)31-18(20(26)27)16-9-6-10-17(13-16)24-21(22)23/h3-10,13,18,25H,11-12H2,1-2H3,(H4-,22,23,24,26,27)/p+1 |
| InChIKey | IRXDEFRFRHJAHO-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|