C9H13ClN4O — CID 91619584
N-[3-(diaminomethylideneamino)phenyl]acetamide;hydrochloride (PubChem CID 91619584) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is N-[3-(diaminomethylideneamino)phenyl]acetamide;hydrochloride.
| Compound Name | N-[3-(diaminomethylideneamino)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 91619584 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | N-[3-(diaminomethylideneamino)phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1cccc(N=C(N)N)c1.Cl |
| InChI | InChI=1S/C9H12N4O.ClH/c1-6(14)12-7-3-2-4-8(5-7)13-9(10)11;/h2-5H,1H3,(H,12,14)(H4,10,11,13);1H |
| InChIKey | VDIAKBIYYYLBTD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|