C12H19N7O — CID 168602315
N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-(dimethylamino)acetamide (PubChem CID 168602315) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 168602315 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1cccc(/N=C(\N)N=C(N)N)c1 |
| InChI | InChI=1S/C12H19N7O/c1-19(2)7-10(20)16-8-4-3-5-9(6-8)17-12(15)18-11(13)14/h3-6H,7H2,1-2H3,(H,16,20)(H6,13,14,15,17,18) |
| InChIKey | OFKMEQDCUZOXLZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|