C13H19ClN4O — CID 169365615
N-[3-[(1-amino-2-chloroethylidene)amino]-4-methylphenyl]-2-(dimethylamino)acetamide (PubChem CID 169365615) has the molecular formula C13H19ClN4O and a molecular weight of 282.78 g/mol. Its IUPAC name is N-[3-[(1-amino-2-chloroethylidene)amino]-4-methylphenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[(1-amino-2-chloroethylidene)amino]-4-methylphenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 169365615 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-[3-[(1-amino-2-chloroethylidene)amino]-4-methylphenyl]-2-(dimethylamino)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C)cc1/N=C(/N)CCl |
| InChI | InChI=1S/C13H19ClN4O/c1-9-4-5-10(16-13(19)8-18(2)3)6-11(9)17-12(15)7-14/h4-6H,7-8H2,1-3H3,(H2,15,17)(H,16,19) |
| InChIKey | BOZCYFSAQKUNEV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|