C16H16N6O4 — CID 168604737
5-[[3-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]amino]-2-hydroxybenzoic acid (PubChem CID 168604737) has the molecular formula C16H16N6O4 and a molecular weight of 356.34 g/mol. Its IUPAC name is 5-[[3-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[3-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168604737 |
| Molecular Formula | C16H16N6O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 5-[[3-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]amino]-2-hydroxybenzoic acid |
| SMILES | NC(N)=N/C(N)=N/c1cccc(C(=O)Nc2ccc(O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C16H16N6O4/c17-15(18)22-16(19)21-9-3-1-2-8(6-9)13(24)20-10-4-5-12(23)11(7-10)14(25)26/h1-7,23H,(H,20,24)(H,25,26)(H6,17,18,19,21,22) |
| InChIKey | DLXQSDILXZHRJD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 189.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|