C19H24N6O — CID 168603567
N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-4-tert-butylbenzamide (PubChem CID 168603567) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 168603567 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(/N=C(\N)N=C(N)N)c2)cc1 |
| InChI | InChI=1S/C19H24N6O/c1-19(2,3)13-9-7-12(8-10-13)16(26)23-14-5-4-6-15(11-14)24-18(22)25-17(20)21/h4-11H,1-3H3,(H,23,26)(H6,20,21,22,24,25) |
| InChIKey | JWKHTHMKDRIVKY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|