C16H18N6O — CID 168604296
N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-methylbenzamide (PubChem CID 168604296) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-methylbenzamide.
| Compound Name | N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 168604296 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(/N=C(\N)N=C(N)N)c1 |
| InChI | InChI=1S/C16H18N6O/c1-10-5-2-3-8-13(10)14(23)20-11-6-4-7-12(9-11)21-16(19)22-15(17)18/h2-9H,1H3,(H,20,23)(H6,17,18,19,21,22) |
| InChIKey | IIAWDBIDQJULOE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|