C17H20N6O — CID 168602932
3-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-phenylethyl)benzamide (PubChem CID 168602932) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 3-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 168602932 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-phenylethyl)benzamide |
| SMILES | NC(N)=N/C(N)=N/c1cccc(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C17H20N6O/c18-16(19)23-17(20)22-14-8-4-7-13(11-14)15(24)21-10-9-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,21,24)(H6,18,19,20,22,23) |
| InChIKey | QFSQECSOEUZBID-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|