C21H17Cl2NO — CID 86048215
3-(2,6-dichlorophenyl)-N-(2-phenylethyl)benzamide (PubChem CID 86048215) has the molecular formula C21H17Cl2NO and a molecular weight of 370.28 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-(2-phenylethyl)benzamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 86048215 |
| Molecular Formula | C21H17Cl2NO |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1cccc(-c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C21H17Cl2NO/c22-18-10-5-11-19(23)20(18)16-8-4-9-17(14-16)21(25)24-13-12-15-6-2-1-3-7-15/h1-11,14H,12-13H2,(H,24,25) |
| InChIKey | BWINTCPJQNIOFQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |