C17H18N2O6 — CID 168595086
5-[[3-(2,3-dihydroxypropylamino)benzoyl]amino]-2-hydroxybenzoic acid (PubChem CID 168595086) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 5-[[3-(2,3-dihydroxypropylamino)benzoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[3-(2,3-dihydroxypropylamino)benzoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168595086 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 5-[[3-(2,3-dihydroxypropylamino)benzoyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(O)c(C(=O)O)c1)c1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C17H18N2O6/c20-9-13(21)8-18-11-3-1-2-10(6-11)16(23)19-12-4-5-15(22)14(7-12)17(24)25/h1-7,13,18,20-22H,8-9H2,(H,19,23)(H,24,25) |
| InChIKey | XUOMCYXDQLTRIH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|