C15H17N3O3 — CID 168597603
3-(2,3-dihydroxypropylamino)-N-pyridin-3-ylbenzamide (PubChem CID 168597603) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylamino)-N-pyridin-3-ylbenzamide.
| Compound Name | 3-(2,3-dihydroxypropylamino)-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 168597603 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-(2,3-dihydroxypropylamino)-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C15H17N3O3/c19-10-14(20)9-17-12-4-1-3-11(7-12)15(21)18-13-5-2-6-16-8-13/h1-8,14,17,19-20H,9-10H2,(H,18,21) |
| InChIKey | BXQFAXXULDCEBI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |