C18H20ClN3O5 — CID 78333464
5-[[3-(3-aminopropylcarbamoyl)benzoyl]amino]-2-hydroxybenzoic acid;hydrochloride (PubChem CID 78333464) has the molecular formula C18H20ClN3O5 and a molecular weight of 393.83 g/mol. Its IUPAC name is 5-[[3-(3-aminopropylcarbamoyl)benzoyl]amino]-2-hydroxybenzoic acid;hydrochloride.
| Compound Name | 5-[[3-(3-aminopropylcarbamoyl)benzoyl]amino]-2-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 78333464 |
| Molecular Formula | C18H20ClN3O5 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 5-[[3-(3-aminopropylcarbamoyl)benzoyl]amino]-2-hydroxybenzoic acid;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1cccc(C(=O)Nc2ccc(O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C18H19N3O5.ClH/c19-7-2-8-20-16(23)11-3-1-4-12(9-11)17(24)21-13-5-6-15(22)14(10-13)18(25)26;/h1,3-6,9-10,22H,2,7-8,19H2,(H,20,23)(H,21,24)(H,25,26);1H |
| InChIKey | MFZJPQRZNSUMKE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|