C15H23ClN6O — CID 172751827
N-[3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]acetamide;hydrochloride (PubChem CID 172751827) has the molecular formula C15H23ClN6O and a molecular weight of 338.84 g/mol. Its IUPAC name is N-[3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]acetamide;hydrochloride.
| Compound Name | N-[3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 172751827 |
| Molecular Formula | C15H23ClN6O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1cccc(/N=C(\N)N=C(N)N2CCCCC2)c1.Cl |
| InChI | InChI=1S/C15H22N6O.ClH/c1-11(22)18-12-6-5-7-13(10-12)19-14(16)20-15(17)21-8-3-2-4-9-21;/h5-7,10H,2-4,8-9H2,1H3,(H,18,22)(H4,16,17,19,20);1H |
| InChIKey | KMBADQSSJSMGAQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|