C21H24N4O6 — CID 19599277
benzyl N-[3-[[amino(pyrrolidin-1-yl)methylidene]amino]phenyl]carbamate;oxalic acid (PubChem CID 19599277) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is benzyl N-[3-[[amino(pyrrolidin-1-yl)methylidene]amino]phenyl]carbamate;oxalic acid.
| Compound Name | benzyl N-[3-[[amino(pyrrolidin-1-yl)methylidene]amino]phenyl]carbamate;oxalic acid |
|---|---|
| PubChem CID | 19599277 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | benzyl N-[3-[[amino(pyrrolidin-1-yl)methylidene]amino]phenyl]carbamate;oxalic acid |
| SMILES | N/C(=N\c1cccc(NC(=O)OCc2ccccc2)c1)N1CCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H22N4O2.C2H2O4/c20-18(23-11-4-5-12-23)21-16-9-6-10-17(13-16)22-19(24)25-14-15-7-2-1-3-8-15;3-1(4)2(5)6/h1-3,6-10,13H,4-5,11-12,14H2,(H2,20,21)(H,22,24);(H,3,4)(H,5,6) |
| InChIKey | FRVBSNOVLAZEEN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 154.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|