C13H18ClN5 — CID 141426673
N'-[N'-(3-chlorophenyl)carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 141426673) has the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. Its IUPAC name is N'-[N'-(3-chlorophenyl)carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | N'-[N'-(3-chlorophenyl)carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 141426673 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N'-[N'-(3-chlorophenyl)carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N/C(N)=N/c1cccc(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C13H18ClN5/c14-10-5-4-6-11(9-10)17-12(15)18-13(16)19-7-2-1-3-8-19/h4-6,9H,1-3,7-8H2,(H4,15,16,17,18) |
| InChIKey | ZLNKIOGFXSDVHP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|