C32H35ClN5P — CID 158062986
[3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]methyl-triphenylphosphanium chloride (PubChem CID 158062986) has the molecular formula C32H35ClN5P and a molecular weight of 556.09 g/mol. Its IUPAC name is [3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]methyl-triphenylphosphanium chloride.
| Compound Name | [3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]methyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 158062986 |
| Molecular Formula | C32H35ClN5P |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | [3-[[amino-[[amino(piperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]methyl-triphenylphosphanium chloride |
| SMILES | NC(=N/C(N)=N/c1cccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1)N1CCCCC1.[Cl-] |
| InChI | InChI=1S/C32H35N5P.ClH/c33-31(36-32(34)37-22-11-4-12-23-37)35-27-15-13-14-26(24-27)25-38(28-16-5-1-6-17-28,29-18-7-2-8-19-29)30-20-9-3-10-21-30;/h1-3,5-10,13-21,24H,4,11-12,22-23,25H2,(H4,33,34,35,36);1H/q+1;/p-1 |
| InChIKey | FKWJRWOTQCZMFB-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|