C12H18N3O4P — CID 10171753
2-[3-(diaminomethylideneamino)phenyl]-3-[ethyl(hydroxy)phosphoryl]propanoic acid (PubChem CID 10171753) has the molecular formula C12H18N3O4P and a molecular weight of 299.27 g/mol. Its IUPAC name is 2-[3-(diaminomethylideneamino)phenyl]-3-[ethyl(hydroxy)phosphoryl]propanoic acid.
| Compound Name | 2-[3-(diaminomethylideneamino)phenyl]-3-[ethyl(hydroxy)phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 10171753 |
| Molecular Formula | C12H18N3O4P |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-[3-(diaminomethylideneamino)phenyl]-3-[ethyl(hydroxy)phosphoryl]propanoic acid |
| SMILES | CCP(=O)(O)CC(C(=O)O)c1cccc(N=C(N)N)c1 |
| InChI | InChI=1S/C12H18N3O4P/c1-2-20(18,19)7-10(11(16)17)8-4-3-5-9(6-8)15-12(13)14/h3-6,10H,2,7H2,1H3,(H,16,17)(H,18,19)(H4,13,14,15) |
| InChIKey | HLAHFVOEPNSFGN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|