About ethanol;2-phenylguanidine
ethanol;2-phenylguanidine (PubChem CID 172840613) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is ethanol;2-phenylguanidine.
Molecular Properties
| Compound Name | ethanol;2-phenylguanidine |
| PubChem CID | 172840613 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | ethanol;2-phenylguanidine |
| SMILES | CCO.NC(N)=Nc1ccccc1 |
| InChI | InChI=1S/C7H9N3.C2H6O/c8-7(9)10-6-4-2-1-3-5-6;1-2-3/h1-5H,(H4,8,9,10);3H,2H2,1H3 |
| InChIKey | WSYAIERGUYIHCU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-phenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-phenylguanidine?
The IUPAC name of ethanol;2-phenylguanidine (CID 172840613) is ethanol;2-phenylguanidine.
What is the SMILES notation for ethanol;2-phenylguanidine?
The canonical SMILES for ethanol;2-phenylguanidine is CCO.NC(N)=Nc1ccccc1.
What is the InChIKey of ethanol;2-phenylguanidine?
The InChIKey is WSYAIERGUYIHCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6O/c8-7(9)10-6-4-2-1-3-5-6;1-2-3/h1-5H,(H4,8,9,10);3H,2H2,1H3.
What are the key properties of ethanol;2-phenylguanidine?
ethanol;2-phenylguanidine has a molecular weight of 181.24 g/mol, XLogP of 0.59, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-phenylguanidine is sourced from PubChem (CID 172840613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).