About deuteriomethane;ethane;2-phenylguanidine
deuteriomethane;ethane;2-phenylguanidine (PubChem CID 91130505) has the molecular formula C10H19N3
and a molecular weight of 182.29 g/mol. Its IUPAC name is deuteriomethane;ethane;2-phenylguanidine.
Molecular Properties
| Compound Name | deuteriomethane;ethane;2-phenylguanidine |
| PubChem CID | 91130505 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.16 |
| IUPAC Name | deuteriomethane;ethane;2-phenylguanidine |
| SMILES | CC.NC(N)=Nc1ccccc1.[2H]C |
| InChI | InChI=1S/C7H9N3.C2H6.CH4/c8-7(9)10-6-4-2-1-3-5-6;1-2;/h1-5H,(H4,8,9,10);1-2H3;1H4/i;;1D |
| InChIKey | XPNFXZLYCWGADY-PRQZKWGPSA-N |
| XLogP | 2.25 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze deuteriomethane;ethane;2-phenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;ethane;2-phenylguanidine?
The IUPAC name of deuteriomethane;ethane;2-phenylguanidine (CID 91130505) is deuteriomethane;ethane;2-phenylguanidine.
What is the SMILES notation for deuteriomethane;ethane;2-phenylguanidine?
The canonical SMILES for deuteriomethane;ethane;2-phenylguanidine is CC.NC(N)=Nc1ccccc1.[2H]C.
What is the InChIKey of deuteriomethane;ethane;2-phenylguanidine?
The InChIKey is XPNFXZLYCWGADY-PRQZKWGPSA-N. The full InChI is InChI=1S/C7H9N3.C2H6.CH4/c8-7(9)10-6-4-2-1-3-5-6;1-2;/h1-5H,(H4,8,9,10);1-2H3;1H4/i;;1D.
What are the key properties of deuteriomethane;ethane;2-phenylguanidine?
deuteriomethane;ethane;2-phenylguanidine has a molecular weight of 182.29 g/mol, XLogP of 2.25, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;ethane;2-phenylguanidine is sourced from PubChem (CID 91130505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).