C10H14N3O5P — CID 11978479
2-[2-(diaminomethylideneamino)phenyl]-3-phosphonopropanoic acid (PubChem CID 11978479) has the molecular formula C10H14N3O5P and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)phenyl]-3-phosphonopropanoic acid.
| Compound Name | 2-[2-(diaminomethylideneamino)phenyl]-3-phosphonopropanoic acid |
|---|---|
| PubChem CID | 11978479 |
| Molecular Formula | C10H14N3O5P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)phenyl]-3-phosphonopropanoic acid |
| SMILES | NC(N)=Nc1ccccc1C(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C10H14N3O5P/c11-10(12)13-8-4-2-1-3-6(8)7(9(14)15)5-19(16,17)18/h1-4,7H,5H2,(H,14,15)(H4,11,12,13)(H2,16,17,18) |
| InChIKey | ZTDVWKRKVCWRJW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|