C17H20N3O4P — CID 10126157
3-[benzyl(hydroxy)phosphoryl]-2-[3-(diaminomethylideneamino)phenyl]propanoic acid (PubChem CID 10126157) has the molecular formula C17H20N3O4P and a molecular weight of 361.34 g/mol. Its IUPAC name is 3-[benzyl(hydroxy)phosphoryl]-2-[3-(diaminomethylideneamino)phenyl]propanoic acid.
| Compound Name | 3-[benzyl(hydroxy)phosphoryl]-2-[3-(diaminomethylideneamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 10126157 |
| Molecular Formula | C17H20N3O4P |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-[benzyl(hydroxy)phosphoryl]-2-[3-(diaminomethylideneamino)phenyl]propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(CP(=O)(O)Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H20N3O4P/c18-17(19)20-14-8-4-7-13(9-14)15(16(21)22)11-25(23,24)10-12-5-2-1-3-6-12/h1-9,15H,10-11H2,(H,21,22)(H,23,24)(H4,18,19,20) |
| InChIKey | YNEXPOHOFZQKAN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|