C17H16N2O2 — CID 61357169
4,6-dimethyl-1-(2-pyridin-2-ylethyl)indole-2,3-dione (PubChem CID 61357169) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4,6-dimethyl-1-(2-pyridin-2-ylethyl)indole-2,3-dione.
| Compound Name | 4,6-dimethyl-1-(2-pyridin-2-ylethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 61357169 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4,6-dimethyl-1-(2-pyridin-2-ylethyl)indole-2,3-dione |
| SMILES | Cc1cc(C)c2c(c1)N(CCc1ccccn1)C(=O)C2=O |
| InChI | InChI=1S/C17H16N2O2/c1-11-9-12(2)15-14(10-11)19(17(21)16(15)20)8-6-13-5-3-4-7-18-13/h3-5,7,9-10H,6,8H2,1-2H3 |
| InChIKey | HQQNJAROUYLBFP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|