C15H10F2N2O2 — CID 61356316
5,7-difluoro-1-(2-pyridin-2-ylethyl)indole-2,3-dione (PubChem CID 61356316) has the molecular formula C15H10F2N2O2 and a molecular weight of 288.25 g/mol. Its IUPAC name is 5,7-difluoro-1-(2-pyridin-2-ylethyl)indole-2,3-dione.
| Compound Name | 5,7-difluoro-1-(2-pyridin-2-ylethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 61356316 |
| Molecular Formula | C15H10F2N2O2 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5,7-difluoro-1-(2-pyridin-2-ylethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccccn2)c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C15H10F2N2O2/c16-9-7-11-13(12(17)8-9)19(15(21)14(11)20)6-4-10-3-1-2-5-18-10/h1-3,5,7-8H,4,6H2 |
| InChIKey | FZAXYSLFBHIUQB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|