C25H37N3 — CID 139174149
N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-[(2S)-2-pyridin-2-ylpropyl]propanimidamide (PubChem CID 139174149) has the molecular formula C25H37N3 and a molecular weight of 379.59 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-[(2S)-2-pyridin-2-ylpropyl]propanimidamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-[(2S)-2-pyridin-2-ylpropyl]propanimidamide |
|---|---|
| PubChem CID | 139174149 |
| Molecular Formula | C25H37N3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-[(2S)-2-pyridin-2-ylpropyl]propanimidamide |
| SMILES | CC(C)c1cccc(C(C)C)c1N/C(=N/C[C@H](C)c1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C25H37N3/c1-17(2)20-12-11-13-21(18(3)4)23(20)28-24(25(6,7)8)27-16-19(5)22-14-9-10-15-26-22/h9-15,17-19H,16H2,1-8H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | MCGHRTQQTJAFGZ-IBGZPJMESA-N |
| XLogP | 6.99 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|