C26H32N2 — CID 139177638
N-[(2S)-2-phenyl-2-pyridin-2-ylpropyl]-2,6-di(propan-2-yl)aniline (PubChem CID 139177638) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is N-[(2S)-2-phenyl-2-pyridin-2-ylpropyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[(2S)-2-phenyl-2-pyridin-2-ylpropyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 139177638 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-[(2S)-2-phenyl-2-pyridin-2-ylpropyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NC[C@](C)(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C26H32N2/c1-19(2)22-14-11-15-23(20(3)4)25(22)28-18-26(5,21-12-7-6-8-13-21)24-16-9-10-17-27-24/h6-17,19-20,28H,18H2,1-5H3/t26-/m1/s1 |
| InChIKey | QUCMNMXQVKCPMF-AREMUKBSSA-N |
| XLogP | 6.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |