About 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol
3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol (PubChem CID 87967947) has the molecular formula C32H44N2O
and a molecular weight of 472.72 g/mol. Its IUPAC name is 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol.
Molecular Properties
| Compound Name | 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol |
| PubChem CID | 87967947 |
| Molecular Formula | C32H44N2O |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.35 |
| IUPAC Name | 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol |
| SMILES | CCC(O)(CCN(c1c(C(C)C)cccc1C(C)C)C(C)(C)c1ccccn1)Cc1ccccc1 |
| InChI | InChI=1S/C32H44N2O/c1-8-32(35,23-26-15-10-9-11-16-26)20-22-34(31(6,7)29-19-12-13-21-33-29)30-27(24(2)3)17-14-18-28(30)25(4)5/h9-19,21,24-25,35H,8,20,22-23H2,1-7H3 |
| InChIKey | ZENGVLFLWSTRCU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol?
The IUPAC name of 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol (CID 87967947) is 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol.
What is the SMILES notation for 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol?
The canonical SMILES for 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol is CCC(O)(CCN(c1c(C(C)C)cccc1C(C)C)C(C)(C)c1ccccn1)Cc1ccccc1.
What is the InChIKey of 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol?
The InChIKey is ZENGVLFLWSTRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H44N2O/c1-8-32(35,23-26-15-10-9-11-16-26)20-22-34(31(6,7)29-19-12-13-21-33-29)30-27(24(2)3)17-14-18-28(30)25(4)5/h9-19,21,24-25,35H,8,20,22-23H2,1-7H3.
What are the key properties of 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol?
3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol has a molecular weight of 472.72 g/mol, XLogP of 7.84, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1-[2,6-di(propan-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)anilino]pentan-3-ol is sourced from PubChem (CID 87967947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).