About CID 162723245
CID 162723245 (PubChem CID 162723245) has the molecular formula C7H8AlNO
and a molecular weight of 149.13 g/mol.
Molecular Properties
| Compound Name | CID 162723245 |
| PubChem CID | 162723245 |
| Molecular Formula | C7H8AlNO |
| Molecular Weight | 149.13 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | — |
| SMILES | CC(O)([Al])c1ccccn1 |
| InChI | InChI=1S/C7H8NO.Al/c1-6(9)7-4-2-3-5-8-7;/h2-5,9H,1H3; |
| InChIKey | WKUGFBRUZOJESB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 162723245 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162723245?
The IUPAC name of CID 162723245 (CID 162723245) is not available.
What is the SMILES notation for CID 162723245?
The canonical SMILES for CID 162723245 is CC(O)([Al])c1ccccn1.
What is the InChIKey of CID 162723245?
The InChIKey is WKUGFBRUZOJESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8NO.Al/c1-6(9)7-4-2-3-5-8-7;/h2-5,9H,1H3;.
What are the key properties of CID 162723245?
CID 162723245 has a molecular weight of 149.13 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162723245 is sourced from PubChem (CID 162723245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).