C20H22N4 — CID 143616932
3,6-bis(2-pyridin-2-ylpropan-2-yl)pyridazine (PubChem CID 143616932) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3,6-bis(2-pyridin-2-ylpropan-2-yl)pyridazine.
| Compound Name | 3,6-bis(2-pyridin-2-ylpropan-2-yl)pyridazine |
|---|---|
| PubChem CID | 143616932 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3,6-bis(2-pyridin-2-ylpropan-2-yl)pyridazine |
| SMILES | CC(C)(c1ccccn1)c1ccc(C(C)(C)c2ccccn2)nn1 |
| InChI | InChI=1S/C20H22N4/c1-19(2,15-9-5-7-13-21-15)17-11-12-18(24-23-17)20(3,4)16-10-6-8-14-22-16/h5-14H,1-4H3 |
| InChIKey | BLIWQOYEZPZTSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |