C16H22N2O — CID 142343342
ethane;2-methyl-1,1-dipyridin-2-ylpropan-1-ol (PubChem CID 142343342) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is ethane;2-methyl-1,1-dipyridin-2-ylpropan-1-ol.
| Compound Name | ethane;2-methyl-1,1-dipyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 142343342 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | ethane;2-methyl-1,1-dipyridin-2-ylpropan-1-ol |
| SMILES | CC.CC(C)C(O)(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C14H16N2O.C2H6/c1-11(2)14(17,12-7-3-5-9-15-12)13-8-4-6-10-16-13;1-2/h3-11,17H,1-2H3;1-2H3 |
| InChIKey | WMPRHUJYTBAEAQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |