C19H28N2O2Si — CID 10970004
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-dipyridin-2-ylpropan-1-ol (PubChem CID 10970004) has the molecular formula C19H28N2O2Si and a molecular weight of 344.53 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-dipyridin-2-ylpropan-1-ol.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-dipyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 10970004 |
| Molecular Formula | C19H28N2O2Si |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-dipyridin-2-ylpropan-1-ol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C(O)(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C19H28N2O2Si/c1-15(23-24(5,6)18(2,3)4)19(22,16-11-7-9-13-20-16)17-12-8-10-14-21-17/h7-15,22H,1-6H3/t15-/m0/s1 |
| InChIKey | DCEIYRUFGAPZMT-HNNXBMFYSA-N |
| XLogP | 4.12 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|