C15H27NO2Si — CID 10516965
tert-butyl-[(1R,2S)-2-methoxy-1-pyridin-2-ylpropoxy]-dimethylsilane (PubChem CID 10516965) has the molecular formula C15H27NO2Si and a molecular weight of 281.47 g/mol. Its IUPAC name is tert-butyl-[(1R,2S)-2-methoxy-1-pyridin-2-ylpropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S)-2-methoxy-1-pyridin-2-ylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10516965 |
| Molecular Formula | C15H27NO2Si |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | tert-butyl-[(1R,2S)-2-methoxy-1-pyridin-2-ylpropoxy]-dimethylsilane |
| SMILES | CO[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C15H27NO2Si/c1-12(17-5)14(13-10-8-9-11-16-13)18-19(6,7)15(2,3)4/h8-12,14H,1-7H3/t12-,14-/m0/s1 |
| InChIKey | OYZDQWGRJPYPFS-JSGCOSHPSA-N |
| XLogP | 4.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|