C25H40N2O3SSi — CID 175131199
tert-butyl-[[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium (PubChem CID 175131199) has the molecular formula C25H40N2O3SSi and a molecular weight of 476.76 g/mol. Its IUPAC name is tert-butyl-[[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175131199 |
| Molecular Formula | C25H40N2O3SSi |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | tert-butyl-[[1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(COCc1ccccc1)C(O[Si](C)(C)C(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C25H40N2O3SSi/c1-24(2,3)31(28)27-22(19-29-18-20-14-10-9-11-15-20)23(21-16-12-13-17-26-21)30-32(7,8)25(4,5)6/h9-17,22-23,27H,18-19H2,1-8H3 |
| InChIKey | UHFHQZATDYFDSJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 66.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|