C27H44N2O4SSi — CID 175143578
tert-butyl-[[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-phenylmethoxy-1-pyridin-2-ylbutan-2-yl]amino]-oxidosulfanium (PubChem CID 175143578) has the molecular formula C27H44N2O4SSi and a molecular weight of 520.81 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-phenylmethoxy-1-pyridin-2-ylbutan-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-phenylmethoxy-1-pyridin-2-ylbutan-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175143578 |
| Molecular Formula | C27H44N2O4SSi |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | tert-butyl-[[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-phenylmethoxy-1-pyridin-2-ylbutan-2-yl]amino]-oxidosulfanium |
| SMILES | CO[C@H](COCc1ccccc1)[C@@H](N[S+]([O-])C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C27H44N2O4SSi/c1-26(2,3)34(30)29-24(23(31-7)20-32-19-21-15-11-10-12-16-21)25(22-17-13-14-18-28-22)33-35(8,9)27(4,5)6/h10-18,23-25,29H,19-20H2,1-9H3/t23-,24-,25?,34?/m1/s1 |
| InChIKey | BTOCBMBEZCQQNB-LMYXIRIFSA-N |
| XLogP | 5.80 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|