C18H32F2N2O2SSi — CID 175130327
tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoro-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium (PubChem CID 175130327) has the molecular formula C18H32F2N2O2SSi and a molecular weight of 406.62 g/mol. Its IUPAC name is tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoro-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoro-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175130327 |
| Molecular Formula | C18H32F2N2O2SSi |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoro-1-pyridin-2-ylpropan-2-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(CO[Si](C)(C)C(C)(C)C)C(F)(F)c1ccccn1 |
| InChI | InChI=1S/C18H32F2N2O2SSi/c1-16(2,3)25(23)22-15(13-24-26(7,8)17(4,5)6)18(19,20)14-11-9-10-12-21-14/h9-12,15,22H,13H2,1-8H3 |
| InChIKey | YDVWEAXYDRAFOW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|