C23H53NO3SSi2 — CID 175296178
[[(3R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhexan-3-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 175296178) has the molecular formula C23H53NO3SSi2 and a molecular weight of 479.92 g/mol. Its IUPAC name is [[(3R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhexan-3-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(3R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhexan-3-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175296178 |
| Molecular Formula | C23H53NO3SSi2 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | [[(3R,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhexan-3-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)[C@@H](C[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C23H53NO3SSi2/c1-18(2)20(24-28(25)21(3,4)5)16-19(27-30(14,15)23(9,10)11)17-26-29(12,13)22(6,7)8/h18-20,24H,16-17H2,1-15H3/t19-,20-,28?/m1/s1 |
| InChIKey | OHAFVLIGQAYOMA-OGGLPTEMSA-N |
| XLogP | 6.87 |
| TPSA | 53.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|