C15H36O5PSi2+ — CID 88611659
2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy-hydroxy-oxophosphanium (PubChem CID 88611659) has the molecular formula C15H36O5PSi2+ and a molecular weight of 383.59 g/mol. Its IUPAC name is 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy-hydroxy-oxophosphanium.
| Compound Name | 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 88611659 |
| Molecular Formula | C15H36O5PSi2+ |
| Molecular Weight | 383.59 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propoxy-hydroxy-oxophosphanium |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO[P+](=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H35O5PSi2/c1-14(2,3)22(7,8)19-12-13(11-18-21(16)17)20-23(9,10)15(4,5)6/h13H,11-12H2,1-10H3/p+1 |
| InChIKey | NLLPJMSCIMGJNT-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|