C19H40O4Si2 — CID 10500503
(3S,4S)-4-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxetan-2-one (PubChem CID 10500503) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is (3S,4S)-4-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxetan-2-one.
| Compound Name | (3S,4S)-4-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 10500503 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (3S,4S)-4-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-methyloxetan-2-one |
| SMILES | C[C@@H]1C(=O)O[C@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O4Si2/c1-14-16(22-17(14)20)12-15(23-25(10,11)19(5,6)7)13-21-24(8,9)18(2,3)4/h14-16H,12-13H2,1-11H3/t14-,15-,16-/m0/s1 |
| InChIKey | NTNLIFHJLOVOIT-JYJNAYRXSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|