C24H52O3Si3 — CID 11271407
[(1S,3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylbutoxy]-tert-butyl-dimethylsilane (PubChem CID 11271407) has the molecular formula C24H52O3Si3 and a molecular weight of 472.94 g/mol. Its IUPAC name is [(1S,3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylbutoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylbutoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11271407 |
| Molecular Formula | C24H52O3Si3 |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | [(1S,3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-ethynylbutoxy]-tert-butyl-dimethylsilane |
| SMILES | C#C[C@H](C[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O3Si3/c1-17-20(26-29(13,14)23(5,6)7)18-21(27-30(15,16)24(8,9)10)19-25-28(11,12)22(2,3)4/h1,20-21H,18-19H2,2-16H3/t20-,21-/m1/s1 |
| InChIKey | CLRIONAVKMNTCG-NHCUHLMSSA-N |
| XLogP | 7.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|