C16H28O2Si — CID 10612795
6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylocta-2,7-diyn-1-ol (PubChem CID 10612795) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylocta-2,7-diyn-1-ol.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylocta-2,7-diyn-1-ol |
|---|---|
| PubChem CID | 10612795 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylocta-2,7-diyn-1-ol |
| SMILES | C#CC(CC(C)(C)C#CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O2Si/c1-9-14(13-16(5,6)11-10-12-17)18-19(7,8)15(2,3)4/h1,14,17H,12-13H2,2-8H3 |
| InChIKey | UXSNZMATIMHUIR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|