C14H28O4Si — CID 11737786
(3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3,5-dimethyloxan-2-one (PubChem CID 11737786) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3,5-dimethyloxan-2-one.
| Compound Name | (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 11737786 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3,5-dimethyloxan-2-one |
| SMILES | C[C@@H]1[C@H](O)[C@@H](C)C(=O)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O4Si/c1-9-11(18-13(16)10(2)12(9)15)8-17-19(6,7)14(3,4)5/h9-12,15H,8H2,1-7H3/t9-,10+,11-,12-/m0/s1 |
| InChIKey | FFUGCLRSGLRANZ-USZNOCQGSA-N |
| XLogP | 2.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|