C14H30O2Si — CID 59483083
cis-(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethylcyclopentan-1-ol (PubChem CID 59483083) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is cis-(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethylcyclopentan-1-ol.
| Compound Name | cis-(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 59483083 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | cis-(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethylcyclopentan-1-ol |
| SMILES | CC1C(O)C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C14H30O2Si/c1-10-11(2)13(15)8-12(10)9-16-17(6,7)14(3,4)5/h10-13,15H,8-9H2,1-7H3/t10-,11?,12+,13?/m1/s1 |
| InChIKey | TXZIAFRPNLMLOY-IGJPJIBNSA-N |
| XLogP | 3.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|