C17H34O2Si — CID 10924524
(1S,4R,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,8-dimethylbicyclo[5.1.0]octan-3-ol (PubChem CID 10924524) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (1S,4R,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,8-dimethylbicyclo[5.1.0]octan-3-ol.
| Compound Name | (1S,4R,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,8-dimethylbicyclo[5.1.0]octan-3-ol |
|---|---|
| PubChem CID | 10924524 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (1S,4R,7R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,8-dimethylbicyclo[5.1.0]octan-3-ol |
| SMILES | CC1(C)[C@@H]2CC[C@H](CO[Si](C)(C)C(C)(C)C)C(O)C[C@@H]21 |
| InChI | InChI=1S/C17H34O2Si/c1-16(2,3)20(6,7)19-11-12-8-9-13-14(10-15(12)18)17(13,4)5/h12-15,18H,8-11H2,1-7H3/t12-,13-,14+,15?/m1/s1 |
| InChIKey | FMYZQKPMLWIZPY-JKXDFHQYSA-N |
| XLogP | 4.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|