C16H32OSi — CID 11065465
tert-butyl-dimethyl-[[(1S,2S,5S)-5-propan-2-yl-2-bicyclo[3.1.0]hexanyl]methoxy]silane (PubChem CID 11065465) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2S,5S)-5-propan-2-yl-2-bicyclo[3.1.0]hexanyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2S,5S)-5-propan-2-yl-2-bicyclo[3.1.0]hexanyl]methoxy]silane |
|---|---|
| PubChem CID | 11065465 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2S,5S)-5-propan-2-yl-2-bicyclo[3.1.0]hexanyl]methoxy]silane |
| SMILES | CC(C)[C@@]12CC[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C16H32OSi/c1-12(2)16-9-8-13(14(16)10-16)11-17-18(6,7)15(3,4)5/h12-14H,8-11H2,1-7H3/t13-,14+,16+/m1/s1 |
| InChIKey | HYTASVUHWQHAOP-YCPHGPKFSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|