C14H28O3Si — CID 58182336
(3aR,4S,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 58182336) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (3aR,4S,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4S,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 58182336 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (3aR,4S,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC[C@@H]2OC(O)C[C@H]12 |
| InChI | InChI=1S/C14H28O3Si/c1-14(2,3)18(4,5)16-9-10-6-7-12-11(10)8-13(15)17-12/h10-13,15H,6-9H2,1-5H3/t10-,11-,12+,13?/m1/s1 |
| InChIKey | BWMSAUFLYVCKFU-FKJOKYEKSA-N |
| XLogP | 3.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|